C22H29N3O4 — CID 143555576
N-cyclopentyl-2-[(4-methoxyphenyl)methyl]-3-methyl-1,4-dioxo-6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-3-carboxamide (PubChem CID 143555576) has the molecular formula C22H29N3O4 and a molecular weight of 399.49 g/mol. Its IUPAC name is N-cyclopentyl-2-[(4-methoxyphenyl)methyl]-3-methyl-1,4-dioxo-6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-3-carboxamide.
| Compound Name | N-cyclopentyl-2-[(4-methoxyphenyl)methyl]-3-methyl-1,4-dioxo-6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-3-carboxamide |
|---|---|
| PubChem CID | 143555576 |
| Molecular Formula | C22H29N3O4 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | N-cyclopentyl-2-[(4-methoxyphenyl)methyl]-3-methyl-1,4-dioxo-6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-3-carboxamide |
| SMILES | COc1ccc(CN2C(=O)C3CCCN3C(=O)C2(C)C(=O)NC2CCCC2)cc1 |
| InChI | InChI=1S/C22H29N3O4/c1-22(20(27)23-16-6-3-4-7-16)21(28)24-13-5-8-18(24)19(26)25(22)14-15-9-11-17(29-2)12-10-15/h9-12,16,18H,3-8,13-14H2,1-2H3,(H,23,27) |
| InChIKey | QQFVGBRZMMMFIM-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|