C17H18N2O4 — CID 143555604
2-[C-[(7-formyl-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-6-yl)oxy]carbonimidoyl]prop-2-enoic acid (PubChem CID 143555604) has the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is 2-[C-[(7-formyl-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-6-yl)oxy]carbonimidoyl]prop-2-enoic acid.
| Compound Name | 2-[C-[(7-formyl-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-6-yl)oxy]carbonimidoyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 143555604 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 2-[C-[(7-formyl-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-6-yl)oxy]carbonimidoyl]prop-2-enoic acid |
| SMILES | [H]/N=C(/Oc1c(C=O)cc2c3c1CCCN3CCC2)C(=C)C(=O)O |
| InChI | InChI=1S/C17H18N2O4/c1-10(17(21)22)16(18)23-15-12(9-20)8-11-4-2-6-19-7-3-5-13(15)14(11)19/h8-9,18H,1-7H2,(H,21,22)/b18-16+ |
| InChIKey | LJBCDPVGLCWYST-FBMGVBCBSA-N |
| XLogP | 2.19 |
| TPSA | 90.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|