C16H22O4 — CID 14355629
methyl 2-[(2R,8aS)-8a-hydroxy-8,8-dimethyl-7-oxo-2,3,5,6-tetrahydro-1H-naphthalen-2-yl]prop-2-enoate (PubChem CID 14355629) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is methyl 2-[(2R,8aS)-8a-hydroxy-8,8-dimethyl-7-oxo-2,3,5,6-tetrahydro-1H-naphthalen-2-yl]prop-2-enoate.
| Compound Name | methyl 2-[(2R,8aS)-8a-hydroxy-8,8-dimethyl-7-oxo-2,3,5,6-tetrahydro-1H-naphthalen-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 14355629 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | methyl 2-[(2R,8aS)-8a-hydroxy-8,8-dimethyl-7-oxo-2,3,5,6-tetrahydro-1H-naphthalen-2-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)[C@@H]1CC=C2CCC(=O)C(C)(C)[C@]2(O)C1 |
| InChI | InChI=1S/C16H22O4/c1-10(14(18)20-4)11-5-6-12-7-8-13(17)15(2,3)16(12,19)9-11/h6,11,19H,1,5,7-9H2,2-4H3/t11-,16+/m1/s1 |
| InChIKey | CKLCDQSYIGRJKQ-BZNIZROVSA-N |
| XLogP | 2.17 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|