C17H17NO4 — CID 143556330
2-[(2E,4Z)-6-hydroxyhexa-2,4-dien-3-yl]-5-[(E)-prop-1-enoxy]isoindole-1,3-dione (PubChem CID 143556330) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is 2-[(2E,4Z)-6-hydroxyhexa-2,4-dien-3-yl]-5-[(E)-prop-1-enoxy]isoindole-1,3-dione.
| Compound Name | 2-[(2E,4Z)-6-hydroxyhexa-2,4-dien-3-yl]-5-[(E)-prop-1-enoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 143556330 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 2-[(2E,4Z)-6-hydroxyhexa-2,4-dien-3-yl]-5-[(E)-prop-1-enoxy]isoindole-1,3-dione |
| SMILES | C/C=C/Oc1ccc2c(c1)C(=O)N(C(/C=C\CO)=C/C)C2=O |
| InChI | InChI=1S/C17H17NO4/c1-3-10-22-13-7-8-14-15(11-13)17(21)18(16(14)20)12(4-2)6-5-9-19/h3-8,10-11,19H,9H2,1-2H3/b6-5-,10-3+,12-4+ |
| InChIKey | MSHOPNYSMNQCSS-RPCJKOEUSA-N |
| XLogP | 2.65 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|