C17H18F2N2O3 — CID 143556458
(2E,4E)-4-[3-(2,4-difluorophenyl)-2-oxoimidazolidin-1-yl]-2-ethylhexa-2,4-dienoic acid (PubChem CID 143556458) has the molecular formula C17H18F2N2O3 and a molecular weight of 336.34 g/mol. Its IUPAC name is (2E,4E)-4-[3-(2,4-difluorophenyl)-2-oxoimidazolidin-1-yl]-2-ethylhexa-2,4-dienoic acid.
| Compound Name | (2E,4E)-4-[3-(2,4-difluorophenyl)-2-oxoimidazolidin-1-yl]-2-ethylhexa-2,4-dienoic acid |
|---|---|
| PubChem CID | 143556458 |
| Molecular Formula | C17H18F2N2O3 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | (2E,4E)-4-[3-(2,4-difluorophenyl)-2-oxoimidazolidin-1-yl]-2-ethylhexa-2,4-dienoic acid |
| SMILES | C/C=C(\C=C(/CC)C(=O)O)N1CCN(c2ccc(F)cc2F)C1=O |
| InChI | InChI=1S/C17H18F2N2O3/c1-3-11(16(22)23)9-13(4-2)20-7-8-21(17(20)24)15-6-5-12(18)10-14(15)19/h4-6,9-10H,3,7-8H2,1-2H3,(H,22,23)/b11-9+,13-4+ |
| InChIKey | TZFUXXADWDQDTQ-FKGZURGCSA-N |
| XLogP | 3.53 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|