About 3-[3-(3-fluorophenyl)imidazolidin-1-yl]cyclohexa-1,3-diene-1-carboxylic acid
3-[3-(3-fluorophenyl)imidazolidin-1-yl]cyclohexa-1,3-diene-1-carboxylic acid (PubChem CID 143556474) has the molecular formula C16H17FN2O2
and a molecular weight of 288.32 g/mol. Its IUPAC name is 3-[3-(3-fluorophenyl)imidazolidin-1-yl]cyclohexa-1,3-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 3-[3-(3-fluorophenyl)imidazolidin-1-yl]cyclohexa-1,3-diene-1-carboxylic acid |
| PubChem CID | 143556474 |
| Molecular Formula | C16H17FN2O2 |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 3-[3-(3-fluorophenyl)imidazolidin-1-yl]cyclohexa-1,3-diene-1-carboxylic acid |
| SMILES | O=C(O)C1=CC(N2CCN(c3cccc(F)c3)C2)=CCC1 |
| InChI | InChI=1S/C16H17FN2O2/c17-13-4-2-6-15(10-13)19-8-7-18(11-19)14-5-1-3-12(9-14)16(20)21/h2,4-6,9-10H,1,3,7-8,11H2,(H,20,21) |
| InChIKey | XOKPOBAFGLMCDX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[3-(3-fluorophenyl)imidazolidin-1-yl]cyclohexa-1,3-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(3-fluorophenyl)imidazolidin-1-yl]cyclohexa-1,3-diene-1-carboxylic acid?
The IUPAC name of 3-[3-(3-fluorophenyl)imidazolidin-1-yl]cyclohexa-1,3-diene-1-carboxylic acid (CID 143556474) is 3-[3-(3-fluorophenyl)imidazolidin-1-yl]cyclohexa-1,3-diene-1-carboxylic acid.
What is the SMILES notation for 3-[3-(3-fluorophenyl)imidazolidin-1-yl]cyclohexa-1,3-diene-1-carboxylic acid?
The canonical SMILES for 3-[3-(3-fluorophenyl)imidazolidin-1-yl]cyclohexa-1,3-diene-1-carboxylic acid is O=C(O)C1=CC(N2CCN(c3cccc(F)c3)C2)=CCC1.
What is the InChIKey of 3-[3-(3-fluorophenyl)imidazolidin-1-yl]cyclohexa-1,3-diene-1-carboxylic acid?
The InChIKey is XOKPOBAFGLMCDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17FN2O2/c17-13-4-2-6-15(10-13)19-8-7-18(11-19)14-5-1-3-12(9-14)16(20)21/h2,4-6,9-10H,1,3,7-8,11H2,(H,20,21).
What are the key properties of 3-[3-(3-fluorophenyl)imidazolidin-1-yl]cyclohexa-1,3-diene-1-carboxylic acid?
3-[3-(3-fluorophenyl)imidazolidin-1-yl]cyclohexa-1,3-diene-1-carboxylic acid has a molecular weight of 288.32 g/mol, XLogP of 2.59, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(3-fluorophenyl)imidazolidin-1-yl]cyclohexa-1,3-diene-1-carboxylic acid is sourced from PubChem (CID 143556474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).