About (2Z)-7-(1,1-dimethoxyethyl)-3-methyl-9-propan-2-ylidenecyclonon-2-en-1-one
(2Z)-7-(1,1-dimethoxyethyl)-3-methyl-9-propan-2-ylidenecyclonon-2-en-1-one (PubChem CID 14355670) has the molecular formula C17H28O3
and a molecular weight of 280.41 g/mol. Its IUPAC name is (2Z)-7-(1,1-dimethoxyethyl)-3-methyl-9-propan-2-ylidenecyclonon-2-en-1-one.
Molecular Properties
| Compound Name | (2Z)-7-(1,1-dimethoxyethyl)-3-methyl-9-propan-2-ylidenecyclonon-2-en-1-one |
| PubChem CID | 14355670 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | (2Z)-7-(1,1-dimethoxyethyl)-3-methyl-9-propan-2-ylidenecyclonon-2-en-1-one |
| SMILES | COC(C)(OC)C1CCC/C(C)=C\C(=O)C(=C(C)C)C1 |
| InChI | InChI=1S/C17H28O3/c1-12(2)15-11-14(17(4,19-5)20-6)9-7-8-13(3)10-16(15)18/h10,14H,7-9,11H2,1-6H3/b13-10- |
| InChIKey | KVOOSXYCMHHNCT-RAXLEYEMSA-N |
| XLogP | 4.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-7-(1,1-dimethoxyethyl)-3-methyl-9-propan-2-ylidenecyclonon-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-7-(1,1-dimethoxyethyl)-3-methyl-9-propan-2-ylidenecyclonon-2-en-1-one?
The IUPAC name of (2Z)-7-(1,1-dimethoxyethyl)-3-methyl-9-propan-2-ylidenecyclonon-2-en-1-one (CID 14355670) is (2Z)-7-(1,1-dimethoxyethyl)-3-methyl-9-propan-2-ylidenecyclonon-2-en-1-one.
What is the SMILES notation for (2Z)-7-(1,1-dimethoxyethyl)-3-methyl-9-propan-2-ylidenecyclonon-2-en-1-one?
The canonical SMILES for (2Z)-7-(1,1-dimethoxyethyl)-3-methyl-9-propan-2-ylidenecyclonon-2-en-1-one is COC(C)(OC)C1CCC/C(C)=C\C(=O)C(=C(C)C)C1.
What is the InChIKey of (2Z)-7-(1,1-dimethoxyethyl)-3-methyl-9-propan-2-ylidenecyclonon-2-en-1-one?
The InChIKey is KVOOSXYCMHHNCT-RAXLEYEMSA-N. The full InChI is InChI=1S/C17H28O3/c1-12(2)15-11-14(17(4,19-5)20-6)9-7-8-13(3)10-16(15)18/h10,14H,7-9,11H2,1-6H3/b13-10-.
What are the key properties of (2Z)-7-(1,1-dimethoxyethyl)-3-methyl-9-propan-2-ylidenecyclonon-2-en-1-one?
(2Z)-7-(1,1-dimethoxyethyl)-3-methyl-9-propan-2-ylidenecyclonon-2-en-1-one has a molecular weight of 280.41 g/mol, XLogP of 4.04, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-7-(1,1-dimethoxyethyl)-3-methyl-9-propan-2-ylidenecyclonon-2-en-1-one is sourced from PubChem (CID 14355670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).