C19H22N2O3 — CID 143556815
3-[5-[(2E)-2,5-dimethylhexa-2,4-dienyl]-1,2,4-oxadiazol-3-yl]benzoic acid;ethene (PubChem CID 143556815) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is 3-[5-[(2E)-2,5-dimethylhexa-2,4-dienyl]-1,2,4-oxadiazol-3-yl]benzoic acid;ethene.
| Compound Name | 3-[5-[(2E)-2,5-dimethylhexa-2,4-dienyl]-1,2,4-oxadiazol-3-yl]benzoic acid;ethene |
|---|---|
| PubChem CID | 143556815 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 3-[5-[(2E)-2,5-dimethylhexa-2,4-dienyl]-1,2,4-oxadiazol-3-yl]benzoic acid;ethene |
| SMILES | C=C.CC(C)=C/C=C(\C)Cc1nc(-c2cccc(C(=O)O)c2)no1 |
| InChI | InChI=1S/C17H18N2O3.C2H4/c1-11(2)7-8-12(3)9-15-18-16(19-22-15)13-5-4-6-14(10-13)17(20)21;1-2/h4-8,10H,9H2,1-3H3,(H,20,21);1-2H2/b12-8+; |
| InChIKey | RCEODRPIJMQHHD-MXZHIVQLSA-N |
| XLogP | 4.69 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|