C18H18N2O3 — CID 143556975
4-[[(E)-(3-propan-2-ylphenyl)methylideneamino]carbamoyl]benzoic acid (PubChem CID 143556975) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is 4-[[(E)-(3-propan-2-ylphenyl)methylideneamino]carbamoyl]benzoic acid.
| Compound Name | 4-[[(E)-(3-propan-2-ylphenyl)methylideneamino]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 143556975 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 4-[[(E)-(3-propan-2-ylphenyl)methylideneamino]carbamoyl]benzoic acid |
| SMILES | CC(C)c1cccc(/C=N/NC(=O)c2ccc(C(=O)O)cc2)c1 |
| InChI | InChI=1S/C18H18N2O3/c1-12(2)16-5-3-4-13(10-16)11-19-20-17(21)14-6-8-15(9-7-14)18(22)23/h3-12H,1-2H3,(H,20,21)(H,22,23)/b19-11+ |
| InChIKey | NYEIHXYXXZFZSS-YBFXNURJSA-N |
| XLogP | 3.27 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|