C17H16N2O2S — CID 143557263
7-[(1Z,3E)-3-[(Z)-prop-1-enyl]-1-sulfanylhexa-1,3,5-trienyl]-1H-indazole-5-carboxylic acid (PubChem CID 143557263) has the molecular formula C17H16N2O2S and a molecular weight of 312.39 g/mol. Its IUPAC name is 7-[(1Z,3E)-3-[(Z)-prop-1-enyl]-1-sulfanylhexa-1,3,5-trienyl]-1H-indazole-5-carboxylic acid.
| Compound Name | 7-[(1Z,3E)-3-[(Z)-prop-1-enyl]-1-sulfanylhexa-1,3,5-trienyl]-1H-indazole-5-carboxylic acid |
|---|---|
| PubChem CID | 143557263 |
| Molecular Formula | C17H16N2O2S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 7-[(1Z,3E)-3-[(Z)-prop-1-enyl]-1-sulfanylhexa-1,3,5-trienyl]-1H-indazole-5-carboxylic acid |
| SMILES | C=C/C=C(\C=C/C)/C=C(\S)c1cc(C(=O)O)cc2cn[nH]c12 |
| InChI | InChI=1S/C17H16N2O2S/c1-3-5-11(6-4-2)7-15(22)14-9-12(17(20)21)8-13-10-18-19-16(13)14/h3-10,22H,1H2,2H3,(H,18,19)(H,20,21)/b6-4-,11-5+,15-7- |
| InChIKey | HMQPOHADHXKILJ-OYDHUPDTSA-N |
| XLogP | 4.22 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|