About ethane;N,N,3-trimethylbut-3-en-1-amine
ethane;N,N,3-trimethylbut-3-en-1-amine (PubChem CID 143558178) has the molecular formula C9H21N
and a molecular weight of 143.27 g/mol. Its IUPAC name is ethane;N,N,3-trimethylbut-3-en-1-amine.
Molecular Properties
| Compound Name | ethane;N,N,3-trimethylbut-3-en-1-amine |
| PubChem CID | 143558178 |
| Molecular Formula | C9H21N |
| Molecular Weight | 143.27 g/mol |
| Exact Mass | 143.17 |
| IUPAC Name | ethane;N,N,3-trimethylbut-3-en-1-amine |
| SMILES | C=C(C)CCN(C)C.CC |
| InChI | InChI=1S/C7H15N.C2H6/c1-7(2)5-6-8(3)4;1-2/h1,5-6H2,2-4H3;1-2H3 |
| InChIKey | RPNQKMFLAPBUQH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.27 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;N,N,3-trimethylbut-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N,N,3-trimethylbut-3-en-1-amine?
The IUPAC name of ethane;N,N,3-trimethylbut-3-en-1-amine (CID 143558178) is ethane;N,N,3-trimethylbut-3-en-1-amine.
What is the SMILES notation for ethane;N,N,3-trimethylbut-3-en-1-amine?
The canonical SMILES for ethane;N,N,3-trimethylbut-3-en-1-amine is C=C(C)CCN(C)C.CC.
What is the InChIKey of ethane;N,N,3-trimethylbut-3-en-1-amine?
The InChIKey is RPNQKMFLAPBUQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N.C2H6/c1-7(2)5-6-8(3)4;1-2/h1,5-6H2,2-4H3;1-2H3.
What are the key properties of ethane;N,N,3-trimethylbut-3-en-1-amine?
ethane;N,N,3-trimethylbut-3-en-1-amine has a molecular weight of 143.27 g/mol, XLogP of 2.54, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N,N,3-trimethylbut-3-en-1-amine is sourced from PubChem (CID 143558178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).