C17H25NO4 — CID 143558519
(6S)-1-[(R)-cyclohex-2-en-1-yl(hydroxy)methyl]-6-methyl-4-propyl-7-oxa-2-azabicyclo[4.2.0]octane-3,8-dione (PubChem CID 143558519) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is (6S)-1-[(R)-cyclohex-2-en-1-yl(hydroxy)methyl]-6-methyl-4-propyl-7-oxa-2-azabicyclo[4.2.0]octane-3,8-dione.
| Compound Name | (6S)-1-[(R)-cyclohex-2-en-1-yl(hydroxy)methyl]-6-methyl-4-propyl-7-oxa-2-azabicyclo[4.2.0]octane-3,8-dione |
|---|---|
| PubChem CID | 143558519 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | (6S)-1-[(R)-cyclohex-2-en-1-yl(hydroxy)methyl]-6-methyl-4-propyl-7-oxa-2-azabicyclo[4.2.0]octane-3,8-dione |
| SMILES | CCCC1C[C@]2(C)OC(=O)C2([C@H](O)C2C=CCCC2)NC1=O |
| InChI | InChI=1S/C17H25NO4/c1-3-7-12-10-16(2)17(15(21)22-16,18-14(12)20)13(19)11-8-5-4-6-9-11/h5,8,11-13,19H,3-4,6-7,9-10H2,1-2H3,(H,18,20)/t11?,12?,13-,16+,17?/m1/s1 |
| InChIKey | BIHVIGJZNNPVHH-LGKJTXGJSA-N |
| XLogP | 1.69 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|