C20H24N4 — CID 143558593
6-[2-(methylideneamino)ethylidene]-3-[2-(2,3,6,7-tetrahydroazepin-1-yl)-2,3-dihydropyridin-4-yl]cyclohexa-2,4-dien-1-imine (PubChem CID 143558593) has the molecular formula C20H24N4 and a molecular weight of 320.44 g/mol. Its IUPAC name is 6-[2-(methylideneamino)ethylidene]-3-[2-(2,3,6,7-tetrahydroazepin-1-yl)-2,3-dihydropyridin-4-yl]cyclohexa-2,4-dien-1-imine.
| Compound Name | 6-[2-(methylideneamino)ethylidene]-3-[2-(2,3,6,7-tetrahydroazepin-1-yl)-2,3-dihydropyridin-4-yl]cyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 143558593 |
| Molecular Formula | C20H24N4 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 6-[2-(methylideneamino)ethylidene]-3-[2-(2,3,6,7-tetrahydroazepin-1-yl)-2,3-dihydropyridin-4-yl]cyclohexa-2,4-dien-1-imine |
| SMILES | [H]/N=C1\C=C(C2=CC=NC(N3CCC=CCC3)C2)C=CC1=CCN=C |
| InChI | InChI=1S/C20H24N4/c1-22-10-8-16-6-7-17(14-19(16)21)18-9-11-23-20(15-18)24-12-4-2-3-5-13-24/h2-3,6-9,11,14,20-21H,1,4-5,10,12-13,15H2/b16-8?,21-19+ |
| InChIKey | UOWGLBRBTMLIDU-LIZLMLBYSA-N |
| XLogP | 3.51 |
| TPSA | 51.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|