About N-[5-bromo-3-(trifluoromethyl)-2-pyridinyl]-N'-butyl-N'-ethylethane-1,2-diamine
N-[5-bromo-3-(trifluoromethyl)-2-pyridinyl]-N'-butyl-N'-ethylethane-1,2-diamine (PubChem CID 143558642) has the molecular formula C14H21BrF3N3
and a molecular weight of 368.24 g/mol. Its IUPAC name is N-[5-bromo-3-(trifluoromethyl)-2-pyridinyl]-N'-butyl-N'-ethylethane-1,2-diamine.
Molecular Properties
| Compound Name | N-[5-bromo-3-(trifluoromethyl)-2-pyridinyl]-N'-butyl-N'-ethylethane-1,2-diamine |
| PubChem CID | 143558642 |
| Molecular Formula | C14H21BrF3N3 |
| Molecular Weight | 368.24 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | N-[5-bromo-3-(trifluoromethyl)-2-pyridinyl]-N'-butyl-N'-ethylethane-1,2-diamine |
| SMILES | CCCCN(CC)CCNc1ncc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C14H21BrF3N3/c1-3-5-7-21(4-2)8-6-19-13-12(14(16,17)18)9-11(15)10-20-13/h9-10H,3-8H2,1-2H3,(H,19,20) |
| InChIKey | SOYCNQFWBFMLNJ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.24 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[5-bromo-3-(trifluoromethyl)-2-pyridinyl]-N'-butyl-N'-ethylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-bromo-3-(trifluoromethyl)-2-pyridinyl]-N'-butyl-N'-ethylethane-1,2-diamine?
The IUPAC name of N-[5-bromo-3-(trifluoromethyl)-2-pyridinyl]-N'-butyl-N'-ethylethane-1,2-diamine (CID 143558642) is N-[5-bromo-3-(trifluoromethyl)-2-pyridinyl]-N'-butyl-N'-ethylethane-1,2-diamine.
What is the SMILES notation for N-[5-bromo-3-(trifluoromethyl)-2-pyridinyl]-N'-butyl-N'-ethylethane-1,2-diamine?
The canonical SMILES for N-[5-bromo-3-(trifluoromethyl)-2-pyridinyl]-N'-butyl-N'-ethylethane-1,2-diamine is CCCCN(CC)CCNc1ncc(Br)cc1C(F)(F)F.
What is the InChIKey of N-[5-bromo-3-(trifluoromethyl)-2-pyridinyl]-N'-butyl-N'-ethylethane-1,2-diamine?
The InChIKey is SOYCNQFWBFMLNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21BrF3N3/c1-3-5-7-21(4-2)8-6-19-13-12(14(16,17)18)9-11(15)10-20-13/h9-10H,3-8H2,1-2H3,(H,19,20).
What are the key properties of N-[5-bromo-3-(trifluoromethyl)-2-pyridinyl]-N'-butyl-N'-ethylethane-1,2-diamine?
N-[5-bromo-3-(trifluoromethyl)-2-pyridinyl]-N'-butyl-N'-ethylethane-1,2-diamine has a molecular weight of 368.24 g/mol, XLogP of 4.40, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-bromo-3-(trifluoromethyl)-2-pyridinyl]-N'-butyl-N'-ethylethane-1,2-diamine is sourced from PubChem (CID 143558642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).