About 4-ethylphenol;5-ethylsulfanyl-1H-indole-2,3-dione;2-methylpropane
4-ethylphenol;5-ethylsulfanyl-1H-indole-2,3-dione;2-methylpropane (PubChem CID 143558810) has the molecular formula C22H29NO3S
and a molecular weight of 387.55 g/mol. Its IUPAC name is 4-ethylphenol;5-ethylsulfanyl-1H-indole-2,3-dione;2-methylpropane.
Molecular Properties
| Compound Name | 4-ethylphenol;5-ethylsulfanyl-1H-indole-2,3-dione;2-methylpropane |
| PubChem CID | 143558810 |
| Molecular Formula | C22H29NO3S |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 4-ethylphenol;5-ethylsulfanyl-1H-indole-2,3-dione;2-methylpropane |
| SMILES | CC(C)C.CCSc1ccc2c(c1)C(=O)C(=O)N2.CCc1ccc(O)cc1 |
| InChI | InChI=1S/C10H9NO2S.C8H10O.C4H10/c1-2-14-6-3-4-8-7(5-6)9(12)10(13)11-8;1-2-7-3-5-8(9)6-4-7;1-4(2)3/h3-5H,2H2,1H3,(H,11,12,13);3-6,9H,2H2,1H3;4H,1-3H3 |
| InChIKey | QKALXODEVLATSO-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-ethylphenol;5-ethylsulfanyl-1H-indole-2,3-dione;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylphenol;5-ethylsulfanyl-1H-indole-2,3-dione;2-methylpropane?
The IUPAC name of 4-ethylphenol;5-ethylsulfanyl-1H-indole-2,3-dione;2-methylpropane (CID 143558810) is 4-ethylphenol;5-ethylsulfanyl-1H-indole-2,3-dione;2-methylpropane.
What is the SMILES notation for 4-ethylphenol;5-ethylsulfanyl-1H-indole-2,3-dione;2-methylpropane?
The canonical SMILES for 4-ethylphenol;5-ethylsulfanyl-1H-indole-2,3-dione;2-methylpropane is CC(C)C.CCSc1ccc2c(c1)C(=O)C(=O)N2.CCc1ccc(O)cc1.
What is the InChIKey of 4-ethylphenol;5-ethylsulfanyl-1H-indole-2,3-dione;2-methylpropane?
The InChIKey is QKALXODEVLATSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO2S.C8H10O.C4H10/c1-2-14-6-3-4-8-7(5-6)9(12)10(13)11-8;1-2-7-3-5-8(9)6-4-7;1-4(2)3/h3-5H,2H2,1H3,(H,11,12,13);3-6,9H,2H2,1H3;4H,1-3H3.
What are the key properties of 4-ethylphenol;5-ethylsulfanyl-1H-indole-2,3-dione;2-methylpropane?
4-ethylphenol;5-ethylsulfanyl-1H-indole-2,3-dione;2-methylpropane has a molecular weight of 387.55 g/mol, XLogP of 5.55, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylphenol;5-ethylsulfanyl-1H-indole-2,3-dione;2-methylpropane is sourced from PubChem (CID 143558810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).