About ethane;5-ethylsulfanyl-1H-indole-2,3-dione;2-methylpropane
ethane;5-ethylsulfanyl-1H-indole-2,3-dione;2-methylpropane (PubChem CID 143558848) has the molecular formula C16H25NO2S
and a molecular weight of 295.45 g/mol. Its IUPAC name is ethane;5-ethylsulfanyl-1H-indole-2,3-dione;2-methylpropane.
Molecular Properties
| Compound Name | ethane;5-ethylsulfanyl-1H-indole-2,3-dione;2-methylpropane |
| PubChem CID | 143558848 |
| Molecular Formula | C16H25NO2S |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | ethane;5-ethylsulfanyl-1H-indole-2,3-dione;2-methylpropane |
| SMILES | CC.CC(C)C.CCSc1ccc2c(c1)C(=O)C(=O)N2 |
| InChI | InChI=1S/C10H9NO2S.C4H10.C2H6/c1-2-14-6-3-4-8-7(5-6)9(12)10(13)11-8;1-4(2)3;1-2/h3-5H,2H2,1H3,(H,11,12,13);4H,1-3H3;1-2H3 |
| InChIKey | AREURTFKZGRKGO-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze ethane;5-ethylsulfanyl-1H-indole-2,3-dione;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-ethylsulfanyl-1H-indole-2,3-dione;2-methylpropane?
The IUPAC name of ethane;5-ethylsulfanyl-1H-indole-2,3-dione;2-methylpropane (CID 143558848) is ethane;5-ethylsulfanyl-1H-indole-2,3-dione;2-methylpropane.
What is the SMILES notation for ethane;5-ethylsulfanyl-1H-indole-2,3-dione;2-methylpropane?
The canonical SMILES for ethane;5-ethylsulfanyl-1H-indole-2,3-dione;2-methylpropane is CC.CC(C)C.CCSc1ccc2c(c1)C(=O)C(=O)N2.
What is the InChIKey of ethane;5-ethylsulfanyl-1H-indole-2,3-dione;2-methylpropane?
The InChIKey is AREURTFKZGRKGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO2S.C4H10.C2H6/c1-2-14-6-3-4-8-7(5-6)9(12)10(13)11-8;1-4(2)3;1-2/h3-5H,2H2,1H3,(H,11,12,13);4H,1-3H3;1-2H3.
What are the key properties of ethane;5-ethylsulfanyl-1H-indole-2,3-dione;2-methylpropane?
ethane;5-ethylsulfanyl-1H-indole-2,3-dione;2-methylpropane has a molecular weight of 295.45 g/mol, XLogP of 4.62, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-ethylsulfanyl-1H-indole-2,3-dione;2-methylpropane is sourced from PubChem (CID 143558848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).