C20H30O3 — CID 14355901
(4aS,8aS)-8-[(3R)-3-hydroxy-3-methylpent-4-enyl]-4,4,7,8a-tetramethyl-1,3,4a,5-tetrahydronaphthalene-2,6-dione (PubChem CID 14355901) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (4aS,8aS)-8-[(3R)-3-hydroxy-3-methylpent-4-enyl]-4,4,7,8a-tetramethyl-1,3,4a,5-tetrahydronaphthalene-2,6-dione.
| Compound Name | (4aS,8aS)-8-[(3R)-3-hydroxy-3-methylpent-4-enyl]-4,4,7,8a-tetramethyl-1,3,4a,5-tetrahydronaphthalene-2,6-dione |
|---|---|
| PubChem CID | 14355901 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (4aS,8aS)-8-[(3R)-3-hydroxy-3-methylpent-4-enyl]-4,4,7,8a-tetramethyl-1,3,4a,5-tetrahydronaphthalene-2,6-dione |
| SMILES | C=C[C@](C)(O)CCC1=C(C)C(=O)C[C@H]2C(C)(C)CC(=O)C[C@]12C |
| InChI | InChI=1S/C20H30O3/c1-7-19(5,23)9-8-15-13(2)16(22)10-17-18(3,4)11-14(21)12-20(15,17)6/h7,17,23H,1,8-12H2,2-6H3/t17-,19-,20+/m0/s1 |
| InChIKey | KVMJECLNUJFBOG-YSIASYRMSA-N |
| XLogP | 4.00 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|