C15H21N3O6 — CID 143559151
ethyl (2E,4E)-3-[(E)-2-(dimethylamino)ethenyl]-4-nitro-2-[(E)-2-nitroprop-1-enyl]hexa-2,4-dienoate (PubChem CID 143559151) has the molecular formula C15H21N3O6 and a molecular weight of 339.35 g/mol. Its IUPAC name is ethyl (2E,4E)-3-[(E)-2-(dimethylamino)ethenyl]-4-nitro-2-[(E)-2-nitroprop-1-enyl]hexa-2,4-dienoate.
| Compound Name | ethyl (2E,4E)-3-[(E)-2-(dimethylamino)ethenyl]-4-nitro-2-[(E)-2-nitroprop-1-enyl]hexa-2,4-dienoate |
|---|---|
| PubChem CID | 143559151 |
| Molecular Formula | C15H21N3O6 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | ethyl (2E,4E)-3-[(E)-2-(dimethylamino)ethenyl]-4-nitro-2-[(E)-2-nitroprop-1-enyl]hexa-2,4-dienoate |
| SMILES | C/C=C(C(\C=C\N(C)C)=C(/C=C(\C)[N+](=O)[O-])C(=O)OCC)/[N+](=O)[O-] |
| InChI | InChI=1S/C15H21N3O6/c1-6-14(18(22)23)12(8-9-16(4)5)13(15(19)24-7-2)10-11(3)17(20)21/h6,8-10H,7H2,1-5H3/b9-8+,11-10+,13-12+,14-6+ |
| InChIKey | AKWLQOKRQNOXHU-CTKXCBRMSA-N |
| XLogP | 2.28 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|