About fluoro 2-methyl-2-(6-nitro-1,2-dihydroquinolin-3-yl)propanoate
fluoro 2-methyl-2-(6-nitro-1,2-dihydroquinolin-3-yl)propanoate (PubChem CID 143559161) has the molecular formula C13H13FN2O4
and a molecular weight of 280.25 g/mol. Its IUPAC name is fluoro 2-methyl-2-(6-nitro-1,2-dihydroquinolin-3-yl)propanoate.
Molecular Properties
| Compound Name | fluoro 2-methyl-2-(6-nitro-1,2-dihydroquinolin-3-yl)propanoate |
| PubChem CID | 143559161 |
| Molecular Formula | C13H13FN2O4 |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | fluoro 2-methyl-2-(6-nitro-1,2-dihydroquinolin-3-yl)propanoate |
| SMILES | CC(C)(C(=O)OF)C1=Cc2cc([N+](=O)[O-])ccc2NC1 |
| InChI | InChI=1S/C13H13FN2O4/c1-13(2,12(17)20-14)9-5-8-6-10(16(18)19)3-4-11(8)15-7-9/h3-6,15H,7H2,1-2H3 |
| InChIKey | CRCGUFIQBOQDEY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze fluoro 2-methyl-2-(6-nitro-1,2-dihydroquinolin-3-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoro 2-methyl-2-(6-nitro-1,2-dihydroquinolin-3-yl)propanoate?
The IUPAC name of fluoro 2-methyl-2-(6-nitro-1,2-dihydroquinolin-3-yl)propanoate (CID 143559161) is fluoro 2-methyl-2-(6-nitro-1,2-dihydroquinolin-3-yl)propanoate.
What is the SMILES notation for fluoro 2-methyl-2-(6-nitro-1,2-dihydroquinolin-3-yl)propanoate?
The canonical SMILES for fluoro 2-methyl-2-(6-nitro-1,2-dihydroquinolin-3-yl)propanoate is CC(C)(C(=O)OF)C1=Cc2cc([N+](=O)[O-])ccc2NC1.
What is the InChIKey of fluoro 2-methyl-2-(6-nitro-1,2-dihydroquinolin-3-yl)propanoate?
The InChIKey is CRCGUFIQBOQDEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13FN2O4/c1-13(2,12(17)20-14)9-5-8-6-10(16(18)19)3-4-11(8)15-7-9/h3-6,15H,7H2,1-2H3.
What are the key properties of fluoro 2-methyl-2-(6-nitro-1,2-dihydroquinolin-3-yl)propanoate?
fluoro 2-methyl-2-(6-nitro-1,2-dihydroquinolin-3-yl)propanoate has a molecular weight of 280.25 g/mol, XLogP of 2.86, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for fluoro 2-methyl-2-(6-nitro-1,2-dihydroquinolin-3-yl)propanoate is sourced from PubChem (CID 143559161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).