C15H18N2OS — CID 143559282
4-methyl-1,3-dihydroimidazole-2-thione;2-methyl-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 143559282) has the molecular formula C15H18N2OS and a molecular weight of 274.39 g/mol. Its IUPAC name is 4-methyl-1,3-dihydroimidazole-2-thione;2-methyl-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 4-methyl-1,3-dihydroimidazole-2-thione;2-methyl-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 143559282 |
| Molecular Formula | C15H18N2OS |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 4-methyl-1,3-dihydroimidazole-2-thione;2-methyl-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | CC1CCc2ccccc2C1=O.Cc1c[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C11H12O.C4H6N2S/c1-8-6-7-9-4-2-3-5-10(9)11(8)12;1-3-2-5-4(7)6-3/h2-5,8H,6-7H2,1H3;2H,1H3,(H2,5,6,7) |
| InChIKey | FIHNWPPKMXVZTH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|