C28H35N3O2 — CID 143559319
3-[2-[3-(dimethylamino)phenoxy]phenyl]-1-piperazin-1-ylpropan-1-one;toluene (PubChem CID 143559319) has the molecular formula C28H35N3O2 and a molecular weight of 445.61 g/mol. Its IUPAC name is 3-[2-[3-(dimethylamino)phenoxy]phenyl]-1-piperazin-1-ylpropan-1-one;toluene.
| Compound Name | 3-[2-[3-(dimethylamino)phenoxy]phenyl]-1-piperazin-1-ylpropan-1-one;toluene |
|---|---|
| PubChem CID | 143559319 |
| Molecular Formula | C28H35N3O2 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.27 |
| IUPAC Name | 3-[2-[3-(dimethylamino)phenoxy]phenyl]-1-piperazin-1-ylpropan-1-one;toluene |
| SMILES | CN(C)c1cccc(Oc2ccccc2CCC(=O)N2CCNCC2)c1.Cc1ccccc1 |
| InChI | InChI=1S/C21H27N3O2.C7H8/c1-23(2)18-7-5-8-19(16-18)26-20-9-4-3-6-17(20)10-11-21(25)24-14-12-22-13-15-24;1-7-5-3-2-4-6-7/h3-9,16,22H,10-15H2,1-2H3;2-6H,1H3 |
| InChIKey | XZXCKXCQVYTNSO-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |