About N-(3,5-dimethyl-2,3-dihydrothiophen-2-yl)-N'-methylcarbamimidoyl chloride
N-(3,5-dimethyl-2,3-dihydrothiophen-2-yl)-N'-methylcarbamimidoyl chloride (PubChem CID 143559431) has the molecular formula C8H13ClN2S
and a molecular weight of 204.73 g/mol. Its IUPAC name is N-(3,5-dimethyl-2,3-dihydrothiophen-2-yl)-N'-methylcarbamimidoyl chloride.
Molecular Properties
| Compound Name | N-(3,5-dimethyl-2,3-dihydrothiophen-2-yl)-N'-methylcarbamimidoyl chloride |
| PubChem CID | 143559431 |
| Molecular Formula | C8H13ClN2S |
| Molecular Weight | 204.73 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | N-(3,5-dimethyl-2,3-dihydrothiophen-2-yl)-N'-methylcarbamimidoyl chloride |
| SMILES | C/N=C(\Cl)NC1SC(C)=CC1C |
| InChI | InChI=1S/C8H13ClN2S/c1-5-4-6(2)12-7(5)11-8(9)10-3/h4-5,7H,1-3H3,(H,10,11) |
| InChIKey | SVVLJKQMPKTZJF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.73 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-(3,5-dimethyl-2,3-dihydrothiophen-2-yl)-N'-methylcarbamimidoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,5-dimethyl-2,3-dihydrothiophen-2-yl)-N'-methylcarbamimidoyl chloride?
The IUPAC name of N-(3,5-dimethyl-2,3-dihydrothiophen-2-yl)-N'-methylcarbamimidoyl chloride (CID 143559431) is N-(3,5-dimethyl-2,3-dihydrothiophen-2-yl)-N'-methylcarbamimidoyl chloride.
What is the SMILES notation for N-(3,5-dimethyl-2,3-dihydrothiophen-2-yl)-N'-methylcarbamimidoyl chloride?
The canonical SMILES for N-(3,5-dimethyl-2,3-dihydrothiophen-2-yl)-N'-methylcarbamimidoyl chloride is C/N=C(\Cl)NC1SC(C)=CC1C.
What is the InChIKey of N-(3,5-dimethyl-2,3-dihydrothiophen-2-yl)-N'-methylcarbamimidoyl chloride?
The InChIKey is SVVLJKQMPKTZJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13ClN2S/c1-5-4-6(2)12-7(5)11-8(9)10-3/h4-5,7H,1-3H3,(H,10,11).
What are the key properties of N-(3,5-dimethyl-2,3-dihydrothiophen-2-yl)-N'-methylcarbamimidoyl chloride?
N-(3,5-dimethyl-2,3-dihydrothiophen-2-yl)-N'-methylcarbamimidoyl chloride has a molecular weight of 204.73 g/mol, XLogP of 2.41, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,5-dimethyl-2,3-dihydrothiophen-2-yl)-N'-methylcarbamimidoyl chloride is sourced from PubChem (CID 143559431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).