C14H16O2S — CID 143559689
5-[(4Z,6Z)-2-methylocta-2,4,6-trien-3-yl]thiophene-2-carboxylic acid (PubChem CID 143559689) has the molecular formula C14H16O2S and a molecular weight of 248.35 g/mol. Its IUPAC name is 5-[(4Z,6Z)-2-methylocta-2,4,6-trien-3-yl]thiophene-2-carboxylic acid.
| Compound Name | 5-[(4Z,6Z)-2-methylocta-2,4,6-trien-3-yl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 143559689 |
| Molecular Formula | C14H16O2S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 5-[(4Z,6Z)-2-methylocta-2,4,6-trien-3-yl]thiophene-2-carboxylic acid |
| SMILES | C/C=C\C=C/C(=C(C)C)c1ccc(C(=O)O)s1 |
| InChI | InChI=1S/C14H16O2S/c1-4-5-6-7-11(10(2)3)12-8-9-13(17-12)14(15)16/h4-9H,1-3H3,(H,15,16)/b5-4-,7-6- |
| InChIKey | XUELVEPPRLDAQY-RZSVFLSASA-N |
| XLogP | 4.37 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|