About 2-N-[1-[4-(dimethylamino)phenyl]ethenyl]-4-pyridin-4-ylbenzene-1,2-diamine
2-N-[1-[4-(dimethylamino)phenyl]ethenyl]-4-pyridin-4-ylbenzene-1,2-diamine (PubChem CID 143559691) has the molecular formula C21H22N4
and a molecular weight of 330.44 g/mol. Its IUPAC name is 2-N-[1-[4-(dimethylamino)phenyl]ethenyl]-4-pyridin-4-ylbenzene-1,2-diamine.
Molecular Properties
| Compound Name | 2-N-[1-[4-(dimethylamino)phenyl]ethenyl]-4-pyridin-4-ylbenzene-1,2-diamine |
| PubChem CID | 143559691 |
| Molecular Formula | C21H22N4 |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 2-N-[1-[4-(dimethylamino)phenyl]ethenyl]-4-pyridin-4-ylbenzene-1,2-diamine |
| SMILES | C=C(Nc1cc(-c2ccncc2)ccc1N)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C21H22N4/c1-15(16-4-7-19(8-5-16)25(2)3)24-21-14-18(6-9-20(21)22)17-10-12-23-13-11-17/h4-14,24H,1,22H2,2-3H3 |
| InChIKey | LDXXMKLDCNXKHD-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-N-[1-[4-(dimethylamino)phenyl]ethenyl]-4-pyridin-4-ylbenzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-[1-[4-(dimethylamino)phenyl]ethenyl]-4-pyridin-4-ylbenzene-1,2-diamine?
The IUPAC name of 2-N-[1-[4-(dimethylamino)phenyl]ethenyl]-4-pyridin-4-ylbenzene-1,2-diamine (CID 143559691) is 2-N-[1-[4-(dimethylamino)phenyl]ethenyl]-4-pyridin-4-ylbenzene-1,2-diamine.
What is the SMILES notation for 2-N-[1-[4-(dimethylamino)phenyl]ethenyl]-4-pyridin-4-ylbenzene-1,2-diamine?
The canonical SMILES for 2-N-[1-[4-(dimethylamino)phenyl]ethenyl]-4-pyridin-4-ylbenzene-1,2-diamine is C=C(Nc1cc(-c2ccncc2)ccc1N)c1ccc(N(C)C)cc1.
What is the InChIKey of 2-N-[1-[4-(dimethylamino)phenyl]ethenyl]-4-pyridin-4-ylbenzene-1,2-diamine?
The InChIKey is LDXXMKLDCNXKHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N4/c1-15(16-4-7-19(8-5-16)25(2)3)24-21-14-18(6-9-20(21)22)17-10-12-23-13-11-17/h4-14,24H,1,22H2,2-3H3.
What are the key properties of 2-N-[1-[4-(dimethylamino)phenyl]ethenyl]-4-pyridin-4-ylbenzene-1,2-diamine?
2-N-[1-[4-(dimethylamino)phenyl]ethenyl]-4-pyridin-4-ylbenzene-1,2-diamine has a molecular weight of 330.44 g/mol, XLogP of 4.48, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-[1-[4-(dimethylamino)phenyl]ethenyl]-4-pyridin-4-ylbenzene-1,2-diamine is sourced from PubChem (CID 143559691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).