About 10-(6-methoxyhexyl)-2-oxa-5-azabicyclo[9.4.0]pentadeca-1(11),12-diene
10-(6-methoxyhexyl)-2-oxa-5-azabicyclo[9.4.0]pentadeca-1(11),12-diene (PubChem CID 143559741) has the molecular formula C20H35NO2
and a molecular weight of 321.51 g/mol. Its IUPAC name is 10-(6-methoxyhexyl)-2-oxa-5-azabicyclo[9.4.0]pentadeca-1(11),12-diene.
Molecular Properties
| Compound Name | 10-(6-methoxyhexyl)-2-oxa-5-azabicyclo[9.4.0]pentadeca-1(11),12-diene |
| PubChem CID | 143559741 |
| Molecular Formula | C20H35NO2 |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 321.27 |
| IUPAC Name | 10-(6-methoxyhexyl)-2-oxa-5-azabicyclo[9.4.0]pentadeca-1(11),12-diene |
| SMILES | COCCCCCCC1CCCCNCCOC2=C1C=CCC2 |
| InChI | InChI=1S/C20H35NO2/c1-22-16-9-3-2-4-10-18-11-7-8-14-21-15-17-23-20-13-6-5-12-19(18)20/h5,12,18,21H,2-4,6-11,13-17H2,1H3 |
| InChIKey | GJJVZCPBTBMXJW-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 10-(6-methoxyhexyl)-2-oxa-5-azabicyclo[9.4.0]pentadeca-1(11),12-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-(6-methoxyhexyl)-2-oxa-5-azabicyclo[9.4.0]pentadeca-1(11),12-diene?
The IUPAC name of 10-(6-methoxyhexyl)-2-oxa-5-azabicyclo[9.4.0]pentadeca-1(11),12-diene (CID 143559741) is 10-(6-methoxyhexyl)-2-oxa-5-azabicyclo[9.4.0]pentadeca-1(11),12-diene.
What is the SMILES notation for 10-(6-methoxyhexyl)-2-oxa-5-azabicyclo[9.4.0]pentadeca-1(11),12-diene?
The canonical SMILES for 10-(6-methoxyhexyl)-2-oxa-5-azabicyclo[9.4.0]pentadeca-1(11),12-diene is COCCCCCCC1CCCCNCCOC2=C1C=CCC2.
What is the InChIKey of 10-(6-methoxyhexyl)-2-oxa-5-azabicyclo[9.4.0]pentadeca-1(11),12-diene?
The InChIKey is GJJVZCPBTBMXJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H35NO2/c1-22-16-9-3-2-4-10-18-11-7-8-14-21-15-17-23-20-13-6-5-12-19(18)20/h5,12,18,21H,2-4,6-11,13-17H2,1H3.
What are the key properties of 10-(6-methoxyhexyl)-2-oxa-5-azabicyclo[9.4.0]pentadeca-1(11),12-diene?
10-(6-methoxyhexyl)-2-oxa-5-azabicyclo[9.4.0]pentadeca-1(11),12-diene has a molecular weight of 321.51 g/mol, XLogP of 4.59, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10-(6-methoxyhexyl)-2-oxa-5-azabicyclo[9.4.0]pentadeca-1(11),12-diene is sourced from PubChem (CID 143559741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).