C19H37NO — CID 143559760
N,N-diethyl-5-(2-ethylcyclohex-2-en-1-yl)pentanamide;ethane (PubChem CID 143559760) has the molecular formula C19H37NO and a molecular weight of 295.51 g/mol. Its IUPAC name is N,N-diethyl-5-(2-ethylcyclohex-2-en-1-yl)pentanamide;ethane.
| Compound Name | N,N-diethyl-5-(2-ethylcyclohex-2-en-1-yl)pentanamide;ethane |
|---|---|
| PubChem CID | 143559760 |
| Molecular Formula | C19H37NO |
| Molecular Weight | 295.51 g/mol |
| Exact Mass | 295.29 |
| IUPAC Name | N,N-diethyl-5-(2-ethylcyclohex-2-en-1-yl)pentanamide;ethane |
| SMILES | CC.CCC1=CCCCC1CCCCC(=O)N(CC)CC |
| InChI | InChI=1S/C17H31NO.C2H6/c1-4-15-11-7-8-12-16(15)13-9-10-14-17(19)18(5-2)6-3;1-2/h11,16H,4-10,12-14H2,1-3H3;1-2H3 |
| InChIKey | HHSIHHVRFDLMHF-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.51 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|