C12H20N4 — CID 143560435
ethane;N-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-1H-1,2,4-triazol-5-amine (PubChem CID 143560435) has the molecular formula C12H20N4 and a molecular weight of 220.32 g/mol. Its IUPAC name is ethane;N-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-1H-1,2,4-triazol-5-amine.
| Compound Name | ethane;N-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 143560435 |
| Molecular Formula | C12H20N4 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | ethane;N-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-1H-1,2,4-triazol-5-amine |
| SMILES | C/C=C\C=C(/C=C\C)Nc1ncn[nH]1.CC |
| InChI | InChI=1S/C10H14N4.C2H6/c1-3-5-7-9(6-4-2)13-10-11-8-12-14-10;1-2/h3-8H,1-2H3,(H2,11,12,13,14);1-2H3/b5-3-,6-4-,9-7+; |
| InChIKey | SNNJTEHLJKHMQF-ROJZKCAGSA-N |
| XLogP | 3.28 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|