About (3Z)-2-bromo-5-methylhexa-1,3,5-triene;1-chloro-4-methylbenzene;ethane
(3Z)-2-bromo-5-methylhexa-1,3,5-triene;1-chloro-4-methylbenzene;ethane (PubChem CID 143560535) has the molecular formula C16H22BrCl
and a molecular weight of 329.71 g/mol. Its IUPAC name is (3Z)-2-bromo-5-methylhexa-1,3,5-triene;1-chloro-4-methylbenzene;ethane.
Molecular Properties
| Compound Name | (3Z)-2-bromo-5-methylhexa-1,3,5-triene;1-chloro-4-methylbenzene;ethane |
| PubChem CID | 143560535 |
| Molecular Formula | C16H22BrCl |
| Molecular Weight | 329.71 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | (3Z)-2-bromo-5-methylhexa-1,3,5-triene;1-chloro-4-methylbenzene;ethane |
| SMILES | C=C(C)/C=C\C(=C)Br.CC.Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C7H9Br.C7H7Cl.C2H6/c1-6(2)4-5-7(3)8;1-6-2-4-7(8)5-3-6;1-2/h4-5H,1,3H2,2H3;2-5H,1H3;1-2H3/b5-4-;; |
| InChIKey | YSLKSLBKKXMJCU-WNCVTPEDSA-N |
| XLogP | 6.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 329.71 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-2-bromo-5-methylhexa-1,3,5-triene;1-chloro-4-methylbenzene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-2-bromo-5-methylhexa-1,3,5-triene;1-chloro-4-methylbenzene;ethane?
The IUPAC name of (3Z)-2-bromo-5-methylhexa-1,3,5-triene;1-chloro-4-methylbenzene;ethane (CID 143560535) is (3Z)-2-bromo-5-methylhexa-1,3,5-triene;1-chloro-4-methylbenzene;ethane.
What is the SMILES notation for (3Z)-2-bromo-5-methylhexa-1,3,5-triene;1-chloro-4-methylbenzene;ethane?
The canonical SMILES for (3Z)-2-bromo-5-methylhexa-1,3,5-triene;1-chloro-4-methylbenzene;ethane is C=C(C)/C=C\C(=C)Br.CC.Cc1ccc(Cl)cc1.
What is the InChIKey of (3Z)-2-bromo-5-methylhexa-1,3,5-triene;1-chloro-4-methylbenzene;ethane?
The InChIKey is YSLKSLBKKXMJCU-WNCVTPEDSA-N. The full InChI is InChI=1S/C7H9Br.C7H7Cl.C2H6/c1-6(2)4-5-7(3)8;1-6-2-4-7(8)5-3-6;1-2/h4-5H,1,3H2,2H3;2-5H,1H3;1-2H3/b5-4-;;.
What are the key properties of (3Z)-2-bromo-5-methylhexa-1,3,5-triene;1-chloro-4-methylbenzene;ethane?
(3Z)-2-bromo-5-methylhexa-1,3,5-triene;1-chloro-4-methylbenzene;ethane has a molecular weight of 329.71 g/mol, XLogP of 6.70, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-2-bromo-5-methylhexa-1,3,5-triene;1-chloro-4-methylbenzene;ethane is sourced from PubChem (CID 143560535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).