C25H33N3O6S — CID 143561481
(2R)-4-acetyl-N-[2-[4-(dihydroxymethyl)phenyl]ethyl]-1-(4-propan-2-ylphenyl)sulfonylpiperazine-2-carboxamide (PubChem CID 143561481) has the molecular formula C25H33N3O6S and a molecular weight of 503.62 g/mol. Its IUPAC name is (2R)-4-acetyl-N-[2-[4-(dihydroxymethyl)phenyl]ethyl]-1-(4-propan-2-ylphenyl)sulfonylpiperazine-2-carboxamide.
| Compound Name | (2R)-4-acetyl-N-[2-[4-(dihydroxymethyl)phenyl]ethyl]-1-(4-propan-2-ylphenyl)sulfonylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 143561481 |
| Molecular Formula | C25H33N3O6S |
| Molecular Weight | 503.62 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | (2R)-4-acetyl-N-[2-[4-(dihydroxymethyl)phenyl]ethyl]-1-(4-propan-2-ylphenyl)sulfonylpiperazine-2-carboxamide |
| SMILES | CC(=O)N1CCN(S(=O)(=O)c2ccc(C(C)C)cc2)[C@@H](C(=O)NCCc2ccc(C(O)O)cc2)C1 |
| InChI | InChI=1S/C25H33N3O6S/c1-17(2)20-8-10-22(11-9-20)35(33,34)28-15-14-27(18(3)29)16-23(28)24(30)26-13-12-19-4-6-21(7-5-19)25(31)32/h4-11,17,23,25,31-32H,12-16H2,1-3H3,(H,26,30)/t23-/m1/s1 |
| InChIKey | BDEQZBUQKDIBNY-HSZRJFAPSA-N |
| XLogP | 1.37 |
| TPSA | 127.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.62 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|