C9H10F3NO2 — CID 143561692
N-[[4-(difluoromethoxy)-2-fluorocyclohexa-1,3-dien-1-yl]methyl]formamide (PubChem CID 143561692) has the molecular formula C9H10F3NO2 and a molecular weight of 221.18 g/mol. Its IUPAC name is N-[[4-(difluoromethoxy)-2-fluorocyclohexa-1,3-dien-1-yl]methyl]formamide.
| Compound Name | N-[[4-(difluoromethoxy)-2-fluorocyclohexa-1,3-dien-1-yl]methyl]formamide |
|---|---|
| PubChem CID | 143561692 |
| Molecular Formula | C9H10F3NO2 |
| Molecular Weight | 221.18 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | N-[[4-(difluoromethoxy)-2-fluorocyclohexa-1,3-dien-1-yl]methyl]formamide |
| SMILES | O=CNCC1=C(F)C=C(OC(F)F)CC1 |
| InChI | InChI=1S/C9H10F3NO2/c10-8-3-7(15-9(11)12)2-1-6(8)4-13-5-14/h3,5,9H,1-2,4H2,(H,13,14) |
| InChIKey | CKPJVJPIYFIXHB-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.18 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|