C8H8O3 — CID 14356204
(1S,5S)-2-oxabicyclo[3.3.1]non-6-ene-3,4-dione (PubChem CID 14356204) has the molecular formula C8H8O3 and a molecular weight of 152.15 g/mol. Its IUPAC name is (1S,5S)-2-oxabicyclo[3.3.1]non-6-ene-3,4-dione.
| Compound Name | (1S,5S)-2-oxabicyclo[3.3.1]non-6-ene-3,4-dione |
|---|---|
| PubChem CID | 14356204 |
| Molecular Formula | C8H8O3 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.05 |
| IUPAC Name | (1S,5S)-2-oxabicyclo[3.3.1]non-6-ene-3,4-dione |
| SMILES | O=C1O[C@H]2CC=C[C@H](C2)C1=O |
| InChI | InChI=1S/C8H8O3/c9-7-5-2-1-3-6(4-5)11-8(7)10/h1-2,5-6H,3-4H2/t5-,6+/m1/s1 |
| InChIKey | FJJBTANFGFPUQU-RITPCOANSA-N |
| XLogP | 0.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|