C11H24I2N4 — CID 143562163
1,4-diiodo-1,4,8,12-tetrazacyclopentadecane (PubChem CID 143562163) has the molecular formula C11H24I2N4 and a molecular weight of 466.15 g/mol. Its IUPAC name is 1,4-diiodo-1,4,8,12-tetrazacyclopentadecane.
| Compound Name | 1,4-diiodo-1,4,8,12-tetrazacyclopentadecane |
|---|---|
| PubChem CID | 143562163 |
| Molecular Formula | C11H24I2N4 |
| Molecular Weight | 466.15 g/mol |
| Exact Mass | 466.01 |
| IUPAC Name | 1,4-diiodo-1,4,8,12-tetrazacyclopentadecane |
| SMILES | IN1CCCNCCCNCCCN(I)CC1 |
| InChI | InChI=1S/C11H24I2N4/c12-16-8-2-6-14-4-1-5-15-7-3-9-17(13)11-10-16/h14-15H,1-11H2 |
| InChIKey | YVZWPLRBMVPGKM-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.15 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|