C18H27ClN2O3S — CID 143563014
4-tert-butyl-N-(2-chloro-5-sulfamoylcyclohex-3-en-1-yl)-4-methylcyclohexa-1,5-diene-1-carboxamide (PubChem CID 143563014) has the molecular formula C18H27ClN2O3S and a molecular weight of 386.95 g/mol. Its IUPAC name is 4-tert-butyl-N-(2-chloro-5-sulfamoylcyclohex-3-en-1-yl)-4-methylcyclohexa-1,5-diene-1-carboxamide.
| Compound Name | 4-tert-butyl-N-(2-chloro-5-sulfamoylcyclohex-3-en-1-yl)-4-methylcyclohexa-1,5-diene-1-carboxamide |
|---|---|
| PubChem CID | 143563014 |
| Molecular Formula | C18H27ClN2O3S |
| Molecular Weight | 386.95 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 4-tert-butyl-N-(2-chloro-5-sulfamoylcyclohex-3-en-1-yl)-4-methylcyclohexa-1,5-diene-1-carboxamide |
| SMILES | CC(C)(C)C1(C)C=CC(C(=O)NC2CC(S(N)(=O)=O)C=CC2Cl)=CC1 |
| InChI | InChI=1S/C18H27ClN2O3S/c1-17(2,3)18(4)9-7-12(8-10-18)16(22)21-15-11-13(25(20,23)24)5-6-14(15)19/h5-9,13-15H,10-11H2,1-4H3,(H,21,22)(H2,20,23,24) |
| InChIKey | ORTJFYGZVVVMHN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.95 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|