About pyrrolidine-3-carbonyl fluoride
pyrrolidine-3-carbonyl fluoride (PubChem CID 143563092) has the molecular formula C5H8FNO
and a molecular weight of 117.12 g/mol. Its IUPAC name is pyrrolidine-3-carbonyl fluoride.
Molecular Properties
| Compound Name | pyrrolidine-3-carbonyl fluoride |
| PubChem CID | 143563092 |
| Molecular Formula | C5H8FNO |
| Molecular Weight | 117.12 g/mol |
| Exact Mass | 117.06 |
| IUPAC Name | pyrrolidine-3-carbonyl fluoride |
| SMILES | O=C(F)C1CCNC1 |
| InChI | InChI=1S/C5H8FNO/c6-5(8)4-1-2-7-3-4/h4,7H,1-3H2 |
| InChIKey | ZVRHUWJVXRYADP-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.12 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze pyrrolidine-3-carbonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolidine-3-carbonyl fluoride?
The IUPAC name of pyrrolidine-3-carbonyl fluoride (CID 143563092) is pyrrolidine-3-carbonyl fluoride.
What is the SMILES notation for pyrrolidine-3-carbonyl fluoride?
The canonical SMILES for pyrrolidine-3-carbonyl fluoride is O=C(F)C1CCNC1.
What is the InChIKey of pyrrolidine-3-carbonyl fluoride?
The InChIKey is ZVRHUWJVXRYADP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8FNO/c6-5(8)4-1-2-7-3-4/h4,7H,1-3H2.
What are the key properties of pyrrolidine-3-carbonyl fluoride?
pyrrolidine-3-carbonyl fluoride has a molecular weight of 117.12 g/mol, XLogP of 0.09, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolidine-3-carbonyl fluoride is sourced from PubChem (CID 143563092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).