C20H31NO4 — CID 143563459
1-O-tert-butyl 3-O-methyl (3R,4R)-4-[(E)-prop-1-enyl]pyrrolidine-1,3-dicarboxylate;cyclohexa-1,3-diene (PubChem CID 143563459) has the molecular formula C20H31NO4 and a molecular weight of 349.47 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-methyl (3R,4R)-4-[(E)-prop-1-enyl]pyrrolidine-1,3-dicarboxylate;cyclohexa-1,3-diene.
| Compound Name | 1-O-tert-butyl 3-O-methyl (3R,4R)-4-[(E)-prop-1-enyl]pyrrolidine-1,3-dicarboxylate;cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 143563459 |
| Molecular Formula | C20H31NO4 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | 1-O-tert-butyl 3-O-methyl (3R,4R)-4-[(E)-prop-1-enyl]pyrrolidine-1,3-dicarboxylate;cyclohexa-1,3-diene |
| SMILES | C/C=C/[C@H]1CN(C(=O)OC(C)(C)C)C[C@@H]1C(=O)OC.C1=CCCC=C1 |
| InChI | InChI=1S/C14H23NO4.C6H8/c1-6-7-10-8-15(9-11(10)12(16)18-5)13(17)19-14(2,3)4;1-2-4-6-5-3-1/h6-7,10-11H,8-9H2,1-5H3;1-4H,5-6H2/b7-6+;/t10-,11-;/m0./s1 |
| InChIKey | BRHVHVCSHVKJSW-GOEDJKFMSA-N |
| XLogP | 4.11 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|