C19H29N3O3S — CID 143564022
ethyl 2-[[3-[2-imino-2-(methylaminosulfanyl)ethyl]-1,2,4,5-tetrahydro-3-benzazepin-7-yl]oxy]-2-methylpropanoate (PubChem CID 143564022) has the molecular formula C19H29N3O3S and a molecular weight of 379.53 g/mol. Its IUPAC name is ethyl 2-[[3-[2-imino-2-(methylaminosulfanyl)ethyl]-1,2,4,5-tetrahydro-3-benzazepin-7-yl]oxy]-2-methylpropanoate.
| Compound Name | ethyl 2-[[3-[2-imino-2-(methylaminosulfanyl)ethyl]-1,2,4,5-tetrahydro-3-benzazepin-7-yl]oxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 143564022 |
| Molecular Formula | C19H29N3O3S |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | ethyl 2-[[3-[2-imino-2-(methylaminosulfanyl)ethyl]-1,2,4,5-tetrahydro-3-benzazepin-7-yl]oxy]-2-methylpropanoate |
| SMILES | [H]/N=C(/CN1CCc2ccc(OC(C)(C)C(=O)OCC)cc2CC1)SNC |
| InChI | InChI=1S/C19H29N3O3S/c1-5-24-18(23)19(2,3)25-16-7-6-14-8-10-22(11-9-15(14)12-16)13-17(20)26-21-4/h6-7,12,20-21H,5,8-11,13H2,1-4H3/b20-17- |
| InChIKey | MYQCSWDKUKAZNG-JZJYNLBNSA-N |
| XLogP | 2.65 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|