C23H23N3OS — CID 143564351
N-cyclohexyl-6-[[2-(2-cyclopropylethynyl)-4-pyridinyl]oxy]-1,3-benzothiazol-2-amine (PubChem CID 143564351) has the molecular formula C23H23N3OS and a molecular weight of 389.52 g/mol. Its IUPAC name is N-cyclohexyl-6-[[2-(2-cyclopropylethynyl)-4-pyridinyl]oxy]-1,3-benzothiazol-2-amine.
| Compound Name | N-cyclohexyl-6-[[2-(2-cyclopropylethynyl)-4-pyridinyl]oxy]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 143564351 |
| Molecular Formula | C23H23N3OS |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | N-cyclohexyl-6-[[2-(2-cyclopropylethynyl)-4-pyridinyl]oxy]-1,3-benzothiazol-2-amine |
| SMILES | C(#CC1CC1)c1cc(Oc2ccc3nc(NC4CCCCC4)sc3c2)ccn1 |
| InChI | InChI=1S/C23H23N3OS/c1-2-4-17(5-3-1)25-23-26-21-11-10-19(15-22(21)28-23)27-20-12-13-24-18(14-20)9-8-16-6-7-16/h10-17H,1-7H2,(H,25,26) |
| InChIKey | ACNVUEMDYWXQJF-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|