C21H23N5O3S — CID 143564472
4-[[2-[(2-formamidocyclohexyl)amino]-1,3-benzothiazol-6-yl]oxy]-N-methylpyridine-2-carboxamide (PubChem CID 143564472) has the molecular formula C21H23N5O3S and a molecular weight of 425.51 g/mol. Its IUPAC name is 4-[[2-[(2-formamidocyclohexyl)amino]-1,3-benzothiazol-6-yl]oxy]-N-methylpyridine-2-carboxamide.
| Compound Name | 4-[[2-[(2-formamidocyclohexyl)amino]-1,3-benzothiazol-6-yl]oxy]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 143564472 |
| Molecular Formula | C21H23N5O3S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 4-[[2-[(2-formamidocyclohexyl)amino]-1,3-benzothiazol-6-yl]oxy]-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(Oc2ccc3nc(NC4CCCCC4NC=O)sc3c2)ccn1 |
| InChI | InChI=1S/C21H23N5O3S/c1-22-20(28)18-10-14(8-9-23-18)29-13-6-7-17-19(11-13)30-21(26-17)25-16-5-3-2-4-15(16)24-12-27/h6-12,15-16H,2-5H2,1H3,(H,22,28)(H,24,27)(H,25,26) |
| InChIKey | MJDOAIHNAOSGSZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|