About (4-methylcyclohexa-1,5-dien-1-yl)methylurea
(4-methylcyclohexa-1,5-dien-1-yl)methylurea (PubChem CID 143565143) has the molecular formula C9H14N2O
and a molecular weight of 166.22 g/mol. Its IUPAC name is (4-methylcyclohexa-1,5-dien-1-yl)methylurea.
Molecular Properties
| Compound Name | (4-methylcyclohexa-1,5-dien-1-yl)methylurea |
| PubChem CID | 143565143 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | (4-methylcyclohexa-1,5-dien-1-yl)methylurea |
| SMILES | CC1C=CC(CNC(N)=O)=CC1 |
| InChI | InChI=1S/C9H14N2O/c1-7-2-4-8(5-3-7)6-11-9(10)12/h2,4-5,7H,3,6H2,1H3,(H3,10,11,12) |
| InChIKey | VPICNDFALVAJMN-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4-methylcyclohexa-1,5-dien-1-yl)methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylcyclohexa-1,5-dien-1-yl)methylurea?
The IUPAC name of (4-methylcyclohexa-1,5-dien-1-yl)methylurea (CID 143565143) is (4-methylcyclohexa-1,5-dien-1-yl)methylurea.
What is the SMILES notation for (4-methylcyclohexa-1,5-dien-1-yl)methylurea?
The canonical SMILES for (4-methylcyclohexa-1,5-dien-1-yl)methylurea is CC1C=CC(CNC(N)=O)=CC1.
What is the InChIKey of (4-methylcyclohexa-1,5-dien-1-yl)methylurea?
The InChIKey is VPICNDFALVAJMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O/c1-7-2-4-8(5-3-7)6-11-9(10)12/h2,4-5,7H,3,6H2,1H3,(H3,10,11,12).
What are the key properties of (4-methylcyclohexa-1,5-dien-1-yl)methylurea?
(4-methylcyclohexa-1,5-dien-1-yl)methylurea has a molecular weight of 166.22 g/mol, XLogP of 1.18, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylcyclohexa-1,5-dien-1-yl)methylurea is sourced from PubChem (CID 143565143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).