About N-methylaniline;naphthalen-1-ylmethanimine
N-methylaniline;naphthalen-1-ylmethanimine (PubChem CID 143565448) has the molecular formula C18H18N2
and a molecular weight of 262.36 g/mol. Its IUPAC name is N-methylaniline;naphthalen-1-ylmethanimine.
Molecular Properties
| Compound Name | N-methylaniline;naphthalen-1-ylmethanimine |
| PubChem CID | 143565448 |
| Molecular Formula | C18H18N2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | N-methylaniline;naphthalen-1-ylmethanimine |
| SMILES | CNc1ccccc1.[H]/N=C/c1cccc2ccccc12 |
| InChI | InChI=1S/C11H9N.C7H9N/c12-8-10-6-3-5-9-4-1-2-7-11(9)10;1-8-7-5-3-2-4-6-7/h1-8,12H;2-6,8H,1H3/b12-8+; |
| InChIKey | QFAWYKSLFXFCNC-MXZHIVQLSA-N |
| XLogP | 4.57 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-methylaniline;naphthalen-1-ylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylaniline;naphthalen-1-ylmethanimine?
The IUPAC name of N-methylaniline;naphthalen-1-ylmethanimine (CID 143565448) is N-methylaniline;naphthalen-1-ylmethanimine.
What is the SMILES notation for N-methylaniline;naphthalen-1-ylmethanimine?
The canonical SMILES for N-methylaniline;naphthalen-1-ylmethanimine is CNc1ccccc1.[H]/N=C/c1cccc2ccccc12.
What is the InChIKey of N-methylaniline;naphthalen-1-ylmethanimine?
The InChIKey is QFAWYKSLFXFCNC-MXZHIVQLSA-N. The full InChI is InChI=1S/C11H9N.C7H9N/c12-8-10-6-3-5-9-4-1-2-7-11(9)10;1-8-7-5-3-2-4-6-7/h1-8,12H;2-6,8H,1H3/b12-8+;.
What are the key properties of N-methylaniline;naphthalen-1-ylmethanimine?
N-methylaniline;naphthalen-1-ylmethanimine has a molecular weight of 262.36 g/mol, XLogP of 4.57, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylaniline;naphthalen-1-ylmethanimine is sourced from PubChem (CID 143565448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).