C9H22N2 — CID 143565494
1,2-dimethyl-1-[(E)-pent-2-en-2-yl]hydrazine;ethane (PubChem CID 143565494) has the molecular formula C9H22N2 and a molecular weight of 158.29 g/mol. Its IUPAC name is 1,2-dimethyl-1-[(E)-pent-2-en-2-yl]hydrazine;ethane.
| Compound Name | 1,2-dimethyl-1-[(E)-pent-2-en-2-yl]hydrazine;ethane |
|---|---|
| PubChem CID | 143565494 |
| Molecular Formula | C9H22N2 |
| Molecular Weight | 158.29 g/mol |
| Exact Mass | 158.18 |
| IUPAC Name | 1,2-dimethyl-1-[(E)-pent-2-en-2-yl]hydrazine;ethane |
| SMILES | CC.CC/C=C(\C)N(C)NC |
| InChI | InChI=1S/C7H16N2.C2H6/c1-5-6-7(2)9(4)8-3;1-2/h6,8H,5H2,1-4H3;1-2H3/b7-6+; |
| InChIKey | PIQBTSQERVQBCH-UHDJGPCESA-N |
| XLogP | 2.39 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|