C27H34N4O4 — CID 143565949
N-[(Z)-1-amino-3-(methylamino)prop-2-enylidene]-4-methyl-3-[(2-methylpropan-2-yl)oxy]-5-[4-(pyrrolidine-1-carbonyl)phenoxy]benzamide (PubChem CID 143565949) has the molecular formula C27H34N4O4 and a molecular weight of 478.59 g/mol. Its IUPAC name is N-[(Z)-1-amino-3-(methylamino)prop-2-enylidene]-4-methyl-3-[(2-methylpropan-2-yl)oxy]-5-[4-(pyrrolidine-1-carbonyl)phenoxy]benzamide.
| Compound Name | N-[(Z)-1-amino-3-(methylamino)prop-2-enylidene]-4-methyl-3-[(2-methylpropan-2-yl)oxy]-5-[4-(pyrrolidine-1-carbonyl)phenoxy]benzamide |
|---|---|
| PubChem CID | 143565949 |
| Molecular Formula | C27H34N4O4 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | N-[(Z)-1-amino-3-(methylamino)prop-2-enylidene]-4-methyl-3-[(2-methylpropan-2-yl)oxy]-5-[4-(pyrrolidine-1-carbonyl)phenoxy]benzamide |
| SMILES | CN/C=C\C(N)=N\C(=O)c1cc(Oc2ccc(C(=O)N3CCCC3)cc2)c(C)c(OC(C)(C)C)c1 |
| InChI | InChI=1S/C27H34N4O4/c1-18-22(34-21-10-8-19(9-11-21)26(33)31-14-6-7-15-31)16-20(17-23(18)35-27(2,3)4)25(32)30-24(28)12-13-29-5/h8-13,16-17,29H,6-7,14-15H2,1-5H3,(H2,28,30,32)/b13-12- |
| InChIKey | MYXFLQQEKSCLPB-SEYXRHQNSA-N |
| XLogP | 4.43 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|