C17H34N4O — CID 143566750
(Z)-but-2-ene;ethane;N'-ethyl-N'-(2-methylprop-1-enyl)-N-(1,2,4-oxadiazol-3-ylmethyl)ethane-1,2-diamine (PubChem CID 143566750) has the molecular formula C17H34N4O and a molecular weight of 310.49 g/mol. Its IUPAC name is (Z)-but-2-ene;ethane;N'-ethyl-N'-(2-methylprop-1-enyl)-N-(1,2,4-oxadiazol-3-ylmethyl)ethane-1,2-diamine.
| Compound Name | (Z)-but-2-ene;ethane;N'-ethyl-N'-(2-methylprop-1-enyl)-N-(1,2,4-oxadiazol-3-ylmethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 143566750 |
| Molecular Formula | C17H34N4O |
| Molecular Weight | 310.49 g/mol |
| Exact Mass | 310.27 |
| IUPAC Name | (Z)-but-2-ene;ethane;N'-ethyl-N'-(2-methylprop-1-enyl)-N-(1,2,4-oxadiazol-3-ylmethyl)ethane-1,2-diamine |
| SMILES | C/C=C\C.CC.CCN(C=C(C)C)CCNCc1ncon1 |
| InChI | InChI=1S/C11H20N4O.C4H8.C2H6/c1-4-15(8-10(2)3)6-5-12-7-11-13-9-16-14-11;1-3-4-2;1-2/h8-9,12H,4-7H2,1-3H3;3-4H,1-2H3;1-2H3/b;4-3-; |
| InChIKey | FOACBVOJHLIORC-LWFKIUJUSA-N |
| XLogP | 4.01 |
| TPSA | 54.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.49 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|