C15H24FN3O — CID 143566792
2-[4-[(3Z,5E)-5-fluoro-3-methylocta-3,5,7-trien-2-yl]piperazin-1-yl]acetamide (PubChem CID 143566792) has the molecular formula C15H24FN3O and a molecular weight of 281.38 g/mol. Its IUPAC name is 2-[4-[(3Z,5E)-5-fluoro-3-methylocta-3,5,7-trien-2-yl]piperazin-1-yl]acetamide.
| Compound Name | 2-[4-[(3Z,5E)-5-fluoro-3-methylocta-3,5,7-trien-2-yl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 143566792 |
| Molecular Formula | C15H24FN3O |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 2-[4-[(3Z,5E)-5-fluoro-3-methylocta-3,5,7-trien-2-yl]piperazin-1-yl]acetamide |
| SMILES | C=C/C=C(F)\C=C(\C)C(C)N1CCN(CC(N)=O)CC1 |
| InChI | InChI=1S/C15H24FN3O/c1-4-5-14(16)10-12(2)13(3)19-8-6-18(7-9-19)11-15(17)20/h4-5,10,13H,1,6-9,11H2,2-3H3,(H2,17,20)/b12-10-,14-5+ |
| InChIKey | PTAXUJKCNHJRIF-UIZVUTSLSA-N |
| XLogP | 1.46 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|