C19H21N3O3 — CID 143567083
3-cyano-N-[2-[4-(hydroxymethyl)piperidin-1-yl]phenyl]-2H-pyran-6-carboxamide (PubChem CID 143567083) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is 3-cyano-N-[2-[4-(hydroxymethyl)piperidin-1-yl]phenyl]-2H-pyran-6-carboxamide.
| Compound Name | 3-cyano-N-[2-[4-(hydroxymethyl)piperidin-1-yl]phenyl]-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 143567083 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 3-cyano-N-[2-[4-(hydroxymethyl)piperidin-1-yl]phenyl]-2H-pyran-6-carboxamide |
| SMILES | N#CC1=CC=C(C(=O)Nc2ccccc2N2CCC(CO)CC2)OC1 |
| InChI | InChI=1S/C19H21N3O3/c20-11-15-5-6-18(25-13-15)19(24)21-16-3-1-2-4-17(16)22-9-7-14(12-23)8-10-22/h1-6,14,23H,7-10,12-13H2,(H,21,24) |
| InChIKey | QQMLWFZWBLGJGL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |