About 5-[2-chloro-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromene;methanamine
5-[2-chloro-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromene;methanamine (PubChem CID 143567653) has the molecular formula C17H17ClF3NO
and a molecular weight of 343.78 g/mol. Its IUPAC name is 5-[2-chloro-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromene;methanamine.
Molecular Properties
| Compound Name | 5-[2-chloro-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromene;methanamine |
| PubChem CID | 143567653 |
| Molecular Formula | C17H17ClF3NO |
| Molecular Weight | 343.78 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 5-[2-chloro-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromene;methanamine |
| SMILES | CN.FC(F)(F)c1ccc(-c2cccc3c2CCCO3)c(Cl)c1 |
| InChI | InChI=1S/C16H12ClF3O.CH5N/c17-14-9-10(16(18,19)20)6-7-12(14)11-3-1-5-15-13(11)4-2-8-21-15;1-2/h1,3,5-7,9H,2,4,8H2;2H2,1H3 |
| InChIKey | MPUIXGQRRLIOCB-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.78 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[2-chloro-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromene;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-chloro-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromene;methanamine?
The IUPAC name of 5-[2-chloro-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromene;methanamine (CID 143567653) is 5-[2-chloro-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromene;methanamine.
What is the SMILES notation for 5-[2-chloro-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromene;methanamine?
The canonical SMILES for 5-[2-chloro-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromene;methanamine is CN.FC(F)(F)c1ccc(-c2cccc3c2CCCO3)c(Cl)c1.
What is the InChIKey of 5-[2-chloro-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromene;methanamine?
The InChIKey is MPUIXGQRRLIOCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12ClF3O.CH5N/c17-14-9-10(16(18,19)20)6-7-12(14)11-3-1-5-15-13(11)4-2-8-21-15;1-2/h1,3,5-7,9H,2,4,8H2;2H2,1H3.
What are the key properties of 5-[2-chloro-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromene;methanamine?
5-[2-chloro-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromene;methanamine has a molecular weight of 343.78 g/mol, XLogP of 4.93, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-chloro-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromene;methanamine is sourced from PubChem (CID 143567653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).