C21H21Cl2F6N3O6S2 — CID 143567973
(3,5-dichloro-4-ethylphenyl) trifluoromethanesulfonate;1-[2-(trifluoromethylsulfonyl)-4,5,6,7-tetrahydroindazol-5-yl]pyrrolidin-2-one (PubChem CID 143567973) has the molecular formula C21H21Cl2F6N3O6S2 and a molecular weight of 660.44 g/mol. Its IUPAC name is (3,5-dichloro-4-ethylphenyl) trifluoromethanesulfonate;1-[2-(trifluoromethylsulfonyl)-4,5,6,7-tetrahydroindazol-5-yl]pyrrolidin-2-one.
| Compound Name | (3,5-dichloro-4-ethylphenyl) trifluoromethanesulfonate;1-[2-(trifluoromethylsulfonyl)-4,5,6,7-tetrahydroindazol-5-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 143567973 |
| Molecular Formula | C21H21Cl2F6N3O6S2 |
| Molecular Weight | 660.44 g/mol |
| Exact Mass | 659.02 |
| IUPAC Name | (3,5-dichloro-4-ethylphenyl) trifluoromethanesulfonate;1-[2-(trifluoromethylsulfonyl)-4,5,6,7-tetrahydroindazol-5-yl]pyrrolidin-2-one |
| SMILES | CCc1c(Cl)cc(OS(=O)(=O)C(F)(F)F)cc1Cl.O=C1CCCN1C1CCc2nn(S(=O)(=O)C(F)(F)F)cc2C1 |
| InChI | InChI=1S/C12H14F3N3O3S.C9H7Cl2F3O3S/c13-12(14,15)22(20,21)18-7-8-6-9(3-4-10(8)16-18)17-5-1-2-11(17)19;1-2-6-7(10)3-5(4-8(6)11)17-18(15,16)9(12,13)14/h7,9H,1-6H2;3-4H,2H2,1H3 |
| InChIKey | QGQIWNDTIXMXSK-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 115.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.44 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|