C14H13NO2S — CID 143568315
(E,E)-3-(furan-2-yl)-N-(4-methoxyphenyl)sulfanylprop-2-en-1-imine (PubChem CID 143568315) has the molecular formula C14H13NO2S and a molecular weight of 259.33 g/mol. Its IUPAC name is (E,E)-3-(furan-2-yl)-N-(4-methoxyphenyl)sulfanylprop-2-en-1-imine.
| Compound Name | (E,E)-3-(furan-2-yl)-N-(4-methoxyphenyl)sulfanylprop-2-en-1-imine |
|---|---|
| PubChem CID | 143568315 |
| Molecular Formula | C14H13NO2S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | (E,E)-3-(furan-2-yl)-N-(4-methoxyphenyl)sulfanylprop-2-en-1-imine |
| SMILES | COc1ccc(S/N=C/C=C/c2ccco2)cc1 |
| InChI | InChI=1S/C14H13NO2S/c1-16-12-6-8-14(9-7-12)18-15-10-2-4-13-5-3-11-17-13/h2-11H,1H3/b4-2+,15-10+ |
| InChIKey | QBCWZAZKSPLWBI-NYGWLLIDSA-N |
| XLogP | 4.08 |
| TPSA | 34.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|