C20H25NO — CID 143568372
1,1,3,3,5-pentamethyl-2-phenylmethoxyisoindole (PubChem CID 143568372) has the molecular formula C20H25NO and a molecular weight of 295.43 g/mol. Its IUPAC name is 1,1,3,3,5-pentamethyl-2-phenylmethoxyisoindole.
| Compound Name | 1,1,3,3,5-pentamethyl-2-phenylmethoxyisoindole |
|---|---|
| PubChem CID | 143568372 |
| Molecular Formula | C20H25NO |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 1,1,3,3,5-pentamethyl-2-phenylmethoxyisoindole |
| SMILES | Cc1ccc2c(c1)C(C)(C)N(OCc1ccccc1)C2(C)C |
| InChI | InChI=1S/C20H25NO/c1-15-11-12-17-18(13-15)20(4,5)21(19(17,2)3)22-14-16-9-7-6-8-10-16/h6-13H,14H2,1-5H3 |
| InChIKey | QFQONDRMYPBNTG-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |