About ethane;7-methyl-3H-[1,3]oxazolo[4,5-b]pyridin-2-one
ethane;7-methyl-3H-[1,3]oxazolo[4,5-b]pyridin-2-one (PubChem CID 143569330) has the molecular formula C9H12N2O2
and a molecular weight of 180.21 g/mol. Its IUPAC name is ethane;7-methyl-3H-[1,3]oxazolo[4,5-b]pyridin-2-one.
Molecular Properties
| Compound Name | ethane;7-methyl-3H-[1,3]oxazolo[4,5-b]pyridin-2-one |
| PubChem CID | 143569330 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | ethane;7-methyl-3H-[1,3]oxazolo[4,5-b]pyridin-2-one |
| SMILES | CC.Cc1ccnc2[nH]c(=O)oc12 |
| InChI | InChI=1S/C7H6N2O2.C2H6/c1-4-2-3-8-6-5(4)11-7(10)9-6;1-2/h2-3H,1H3,(H,8,9,10);1-2H3 |
| InChIKey | PLEMOIBFAVDHKO-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;7-methyl-3H-[1,3]oxazolo[4,5-b]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;7-methyl-3H-[1,3]oxazolo[4,5-b]pyridin-2-one?
The IUPAC name of ethane;7-methyl-3H-[1,3]oxazolo[4,5-b]pyridin-2-one (CID 143569330) is ethane;7-methyl-3H-[1,3]oxazolo[4,5-b]pyridin-2-one.
What is the SMILES notation for ethane;7-methyl-3H-[1,3]oxazolo[4,5-b]pyridin-2-one?
The canonical SMILES for ethane;7-methyl-3H-[1,3]oxazolo[4,5-b]pyridin-2-one is CC.Cc1ccnc2[nH]c(=O)oc12.
What is the InChIKey of ethane;7-methyl-3H-[1,3]oxazolo[4,5-b]pyridin-2-one?
The InChIKey is PLEMOIBFAVDHKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O2.C2H6/c1-4-2-3-8-6-5(4)11-7(10)9-6;1-2/h2-3H,1H3,(H,8,9,10);1-2H3.
What are the key properties of ethane;7-methyl-3H-[1,3]oxazolo[4,5-b]pyridin-2-one?
ethane;7-methyl-3H-[1,3]oxazolo[4,5-b]pyridin-2-one has a molecular weight of 180.21 g/mol, XLogP of 1.85, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;7-methyl-3H-[1,3]oxazolo[4,5-b]pyridin-2-one is sourced from PubChem (CID 143569330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).